C25H56O4Si3 — CID 10767871
(1R,2S,3S,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclohexan-1-ol (PubChem CID 10767871) has the molecular formula C25H56O4Si3 and a molecular weight of 504.98 g/mol. Its IUPAC name is (1R,2S,3S,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclohexan-1-ol.
| Compound Name | (1R,2S,3S,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 10767871 |
| Molecular Formula | C25H56O4Si3 |
| Molecular Weight | 504.98 g/mol |
| Exact Mass | 504.35 |
| IUPAC Name | (1R,2S,3S,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclohexan-1-ol |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1[C@H](O)C[C@@H](O[Si](C)(C)C(C)(C)C)C[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H56O4Si3/c1-23(2,3)30(10,11)27-18-20-21(26)16-19(28-31(12,13)24(4,5)6)17-22(20)29-32(14,15)25(7,8)9/h19-22,26H,16-18H2,1-15H3/t19-,20+,21-,22+/m1/s1 |
| InChIKey | DKIYOUUGKGIECW-MBDNFAEBSA-N |
| XLogP | 7.56 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.98 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|