C20H42O6SSi2 — CID 10695541
[(1R,2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-oxocyclohexyl] methanesulfonate (PubChem CID 10695541) has the molecular formula C20H42O6SSi2 and a molecular weight of 466.79 g/mol. Its IUPAC name is [(1R,2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-oxocyclohexyl] methanesulfonate.
| Compound Name | [(1R,2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-oxocyclohexyl] methanesulfonate |
|---|---|
| PubChem CID | 10695541 |
| Molecular Formula | C20H42O6SSi2 |
| Molecular Weight | 466.79 g/mol |
| Exact Mass | 466.22 |
| IUPAC Name | [(1R,2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-oxocyclohexyl] methanesulfonate |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H]1[C@@H](O[Si](C)(C)C(C)(C)C)CC(=O)C[C@H]1OS(C)(=O)=O |
| InChI | InChI=1S/C20H42O6SSi2/c1-19(2,3)28(8,9)24-14-16-17(25-27(7,22)23)12-15(21)13-18(16)26-29(10,11)20(4,5)6/h16-18H,12-14H2,1-11H3/t16-,17+,18-/m0/s1 |
| InChIKey | UDVGNXMIICLLGT-KSZLIROESA-N |
| XLogP | 4.72 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.79 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|