C13H26O5S2Si — CID 10150141
2-[(1S,2S)-2-[tert-butyl(dimethyl)silyl]oxy-4-oxocyclopentyl]sulfanylethanesulfonic acid (PubChem CID 10150141) has the molecular formula C13H26O5S2Si and a molecular weight of 354.57 g/mol. Its IUPAC name is 2-[(1S,2S)-2-[tert-butyl(dimethyl)silyl]oxy-4-oxocyclopentyl]sulfanylethanesulfonic acid.
| Compound Name | 2-[(1S,2S)-2-[tert-butyl(dimethyl)silyl]oxy-4-oxocyclopentyl]sulfanylethanesulfonic acid |
|---|---|
| PubChem CID | 10150141 |
| Molecular Formula | C13H26O5S2Si |
| Molecular Weight | 354.57 g/mol |
| Exact Mass | 354.10 |
| IUPAC Name | 2-[(1S,2S)-2-[tert-butyl(dimethyl)silyl]oxy-4-oxocyclopentyl]sulfanylethanesulfonic acid |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1CC(=O)C[C@@H]1SCCS(=O)(=O)O |
| InChI | InChI=1S/C13H26O5S2Si/c1-13(2,3)21(4,5)18-11-8-10(14)9-12(11)19-6-7-20(15,16)17/h11-12H,6-9H2,1-5H3,(H,15,16,17)/t11-,12-/m0/s1 |
| InChIKey | QNYLCVBKCOBSRX-RYUDHWBXSA-N |
| XLogP | 2.73 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.57 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|