C15H26F3NO4Si — CID 101216486
N-[(1R,2R,6R)-2-[tert-butyl(dimethyl)silyl]oxy-6-(hydroxymethyl)-4-oxocyclohexyl]-2,2,2-trifluoroacetamide (PubChem CID 101216486) has the molecular formula C15H26F3NO4Si and a molecular weight of 369.46 g/mol. Its IUPAC name is N-[(1R,2R,6R)-2-[tert-butyl(dimethyl)silyl]oxy-6-(hydroxymethyl)-4-oxocyclohexyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[(1R,2R,6R)-2-[tert-butyl(dimethyl)silyl]oxy-6-(hydroxymethyl)-4-oxocyclohexyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 101216486 |
| Molecular Formula | C15H26F3NO4Si |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | N-[(1R,2R,6R)-2-[tert-butyl(dimethyl)silyl]oxy-6-(hydroxymethyl)-4-oxocyclohexyl]-2,2,2-trifluoroacetamide |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1CC(=O)C[C@@H](CO)[C@H]1NC(=O)C(F)(F)F |
| InChI | InChI=1S/C15H26F3NO4Si/c1-14(2,3)24(4,5)23-11-7-10(21)6-9(8-20)12(11)19-13(22)15(16,17)18/h9,11-12,20H,6-8H2,1-5H3,(H,19,22)/t9-,11+,12+/m0/s1 |
| InChIKey | RQADYVLQIPEOGA-MVWJERBFSA-N |
| XLogP | 2.40 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|