C12H26O2Si — CID 170904845
[(1R,2R)-2-[tert-butyl(dimethyl)silyl]oxycyclopentyl]methanol (PubChem CID 170904845) has the molecular formula C12H26O2Si and a molecular weight of 230.42 g/mol. Its IUPAC name is [(1R,2R)-2-[tert-butyl(dimethyl)silyl]oxycyclopentyl]methanol.
| Compound Name | [(1R,2R)-2-[tert-butyl(dimethyl)silyl]oxycyclopentyl]methanol |
|---|---|
| PubChem CID | 170904845 |
| Molecular Formula | C12H26O2Si |
| Molecular Weight | 230.42 g/mol |
| Exact Mass | 230.17 |
| IUPAC Name | [(1R,2R)-2-[tert-butyl(dimethyl)silyl]oxycyclopentyl]methanol |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1CCC[C@@H]1CO |
| InChI | InChI=1S/C12H26O2Si/c1-12(2,3)15(4,5)14-11-8-6-7-10(11)9-13/h10-11,13H,6-9H2,1-5H3/t10-,11-/m1/s1 |
| InChIKey | QRELYVHEPVDASS-GHMZBOCLSA-N |
| XLogP | 3.17 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.42 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|