C19H36O2Si — CID 53348300
[(1R,4R,6S,7R,10R,11S)-10-[tert-butyl(dimethyl)silyl]oxy-6-tricyclo[5.3.2.04,11]dodecanyl]methanol (PubChem CID 53348300) has the molecular formula C19H36O2Si and a molecular weight of 324.58 g/mol. Its IUPAC name is [(1R,4R,6S,7R,10R,11S)-10-[tert-butyl(dimethyl)silyl]oxy-6-tricyclo[5.3.2.04,11]dodecanyl]methanol.
| Compound Name | [(1R,4R,6S,7R,10R,11S)-10-[tert-butyl(dimethyl)silyl]oxy-6-tricyclo[5.3.2.04,11]dodecanyl]methanol |
|---|---|
| PubChem CID | 53348300 |
| Molecular Formula | C19H36O2Si |
| Molecular Weight | 324.58 g/mol |
| Exact Mass | 324.25 |
| IUPAC Name | [(1R,4R,6S,7R,10R,11S)-10-[tert-butyl(dimethyl)silyl]oxy-6-tricyclo[5.3.2.04,11]dodecanyl]methanol |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1CC[C@@H]2C[C@H]3[C@H](CC[C@H]31)C[C@@H]2CO |
| InChI | InChI=1S/C19H36O2Si/c1-19(2,3)22(4,5)21-18-9-7-13-11-17-14(6-8-16(17)18)10-15(13)12-20/h13-18,20H,6-12H2,1-5H3/t13-,14-,15-,16-,17+,18-/m1/s1 |
| InChIKey | LNEPYGXJLJOHSP-NKXHUJMZSA-N |
| XLogP | 4.83 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.58 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|