C11H25BO3PSi — CID 66680973
CID 66680973 (PubChem CID 66680973) has the molecular formula C11H25BO3PSi and a molecular weight of 275.19 g/mol.
| Compound Name | CID 66680973 |
|---|---|
| PubChem CID | 66680973 |
| Molecular Formula | C11H25BO3PSi |
| Molecular Weight | 275.19 g/mol |
| Exact Mass | 275.14 |
| IUPAC Name | — |
| SMILES | CC(C)(C)[Si](C)(C)OC1C[C@H]([B]P)O[C@@H]1CO |
| InChI | InChI=1S/C11H25BO3PSi/c1-11(2,3)17(4,5)15-8-6-10(12-16)14-9(8)7-13/h8-10,13H,6-7,16H2,1-5H3/t8?,9-,10-/m1/s1 |
| InChIKey | DCINEHBERJHMMC-VXRWAFEHSA-N |
| XLogP | 1.98 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.19 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|