C17H28O4Si — CID 102266258
3-[(2R,4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-(hydroxymethyl)oxolan-2-yl]phenol (PubChem CID 102266258) has the molecular formula C17H28O4Si and a molecular weight of 324.49 g/mol. Its IUPAC name is 3-[(2R,4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-(hydroxymethyl)oxolan-2-yl]phenol.
| Compound Name | 3-[(2R,4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-(hydroxymethyl)oxolan-2-yl]phenol |
|---|---|
| PubChem CID | 102266258 |
| Molecular Formula | C17H28O4Si |
| Molecular Weight | 324.49 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | 3-[(2R,4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-(hydroxymethyl)oxolan-2-yl]phenol |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1C[C@H](c2cccc(O)c2)O[C@@H]1CO |
| InChI | InChI=1S/C17H28O4Si/c1-17(2,3)22(4,5)21-15-10-14(20-16(15)11-18)12-7-6-8-13(19)9-12/h6-9,14-16,18-19H,10-11H2,1-5H3/t14-,15+,16-/m1/s1 |
| InChIKey | KPTUQVPLIDXIEU-OWCLPIDISA-N |
| XLogP | 3.60 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.49 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|