C20H32O2Si — CID 42643409
[(2R,3R,5R)-5-benzyl-2-prop-2-enyloxolan-3-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 42643409) has the molecular formula C20H32O2Si and a molecular weight of 332.56 g/mol. Its IUPAC name is [(2R,3R,5R)-5-benzyl-2-prop-2-enyloxolan-3-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(2R,3R,5R)-5-benzyl-2-prop-2-enyloxolan-3-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 42643409 |
| Molecular Formula | C20H32O2Si |
| Molecular Weight | 332.56 g/mol |
| Exact Mass | 332.22 |
| IUPAC Name | [(2R,3R,5R)-5-benzyl-2-prop-2-enyloxolan-3-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | C=CC[C@H]1O[C@H](Cc2ccccc2)C[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H32O2Si/c1-7-11-18-19(22-23(5,6)20(2,3)4)15-17(21-18)14-16-12-9-8-10-13-16/h7-10,12-13,17-19H,1,11,14-15H2,2-6H3/t17-,18-,19-/m1/s1 |
| InChIKey | MYIYHAVCZCGCTB-GUDVDZBRSA-N |
| XLogP | 5.35 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.56 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|