C38H44O4Si — CID 11961542
tert-butyl-[(2R,3R,5S)-2-[(3-methoxy-4-phenylmethoxyphenyl)methyl]-5-prop-2-enyloxolan-3-yl]oxy-diphenylsilane (PubChem CID 11961542) has the molecular formula C38H44O4Si and a molecular weight of 592.85 g/mol. Its IUPAC name is tert-butyl-[(2R,3R,5S)-2-[(3-methoxy-4-phenylmethoxyphenyl)methyl]-5-prop-2-enyloxolan-3-yl]oxy-diphenylsilane.
| Compound Name | tert-butyl-[(2R,3R,5S)-2-[(3-methoxy-4-phenylmethoxyphenyl)methyl]-5-prop-2-enyloxolan-3-yl]oxy-diphenylsilane |
|---|---|
| PubChem CID | 11961542 |
| Molecular Formula | C38H44O4Si |
| Molecular Weight | 592.85 g/mol |
| Exact Mass | 592.30 |
| IUPAC Name | tert-butyl-[(2R,3R,5S)-2-[(3-methoxy-4-phenylmethoxyphenyl)methyl]-5-prop-2-enyloxolan-3-yl]oxy-diphenylsilane |
| SMILES | C=CC[C@H]1C[C@@H](O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@@H](Cc2ccc(OCc3ccccc3)c(OC)c2)O1 |
| InChI | InChI=1S/C38H44O4Si/c1-6-16-31-27-37(42-43(38(2,3)4,32-19-12-8-13-20-32)33-21-14-9-15-22-33)36(41-31)26-30-23-24-34(35(25-30)39-5)40-28-29-17-10-7-11-18-29/h6-15,17-25,31,36-37H,1,16,26-28H2,2-5H3/t31-,36+,37+/m0/s1 |
| InChIKey | UMNJGFSNFNEFDZ-JUGYDRJISA-N |
| XLogP | 7.50 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.85 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|