C36H46O5Si — CID 11628524
2-[(2S,3R,5Z,8R,9S)-8-[tert-butyl(diphenyl)silyl]oxy-9-ethyl-3-[(4-methoxyphenyl)methoxy]-2,3,4,7,8,9-hexahydrooxonin-2-yl]acetaldehyde (PubChem CID 11628524) has the molecular formula C36H46O5Si and a molecular weight of 586.85 g/mol. Its IUPAC name is 2-[(2S,3R,5Z,8R,9S)-8-[tert-butyl(diphenyl)silyl]oxy-9-ethyl-3-[(4-methoxyphenyl)methoxy]-2,3,4,7,8,9-hexahydrooxonin-2-yl]acetaldehyde.
| Compound Name | 2-[(2S,3R,5Z,8R,9S)-8-[tert-butyl(diphenyl)silyl]oxy-9-ethyl-3-[(4-methoxyphenyl)methoxy]-2,3,4,7,8,9-hexahydrooxonin-2-yl]acetaldehyde |
|---|---|
| PubChem CID | 11628524 |
| Molecular Formula | C36H46O5Si |
| Molecular Weight | 586.85 g/mol |
| Exact Mass | 586.31 |
| IUPAC Name | 2-[(2S,3R,5Z,8R,9S)-8-[tert-butyl(diphenyl)silyl]oxy-9-ethyl-3-[(4-methoxyphenyl)methoxy]-2,3,4,7,8,9-hexahydrooxonin-2-yl]acetaldehyde |
| SMILES | CC[C@@H]1O[C@@H](CC=O)[C@H](OCc2ccc(OC)cc2)C/C=C\C[C@H]1O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C36H46O5Si/c1-6-32-35(41-42(36(2,3)4,30-15-9-7-10-16-30)31-17-11-8-12-18-31)20-14-13-19-33(34(40-32)25-26-37)39-27-28-21-23-29(38-5)24-22-28/h7-18,21-24,26,32-35H,6,19-20,25,27H2,1-5H3/b14-13-/t32-,33+,34-,35+/m0/s1 |
| InChIKey | KONSRLPTQGKOSQ-JJBSRMOQSA-N |
| XLogP | 6.63 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.85 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|