C38H46BO6PSi — CID 91298006
CID 91298006 (PubChem CID 91298006) has the molecular formula C38H46BO6PSi and a molecular weight of 668.65 g/mol.
| Compound Name | CID 91298006 |
|---|---|
| PubChem CID | 91298006 |
| Molecular Formula | C38H46BO6PSi |
| Molecular Weight | 668.65 g/mol |
| Exact Mass | 668.29 |
| IUPAC Name | — |
| SMILES | [B]P(C)OC1[C@H](OC)OC(CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C38H46BO6PSi/c1-38(2,3)47(31-22-14-8-15-23-31,32-24-16-9-17-25-32)43-28-33-34(41-26-29-18-10-6-11-19-29)35(42-27-30-20-12-7-13-21-30)36(45-46(5)39)37(40-4)44-33/h6-25,33-37H,26-28H2,1-5H3/t33?,34-,35+,36?,37+,46?/m0/s1 |
| InChIKey | HIOPJFDWBNDLHJ-BOGIRMEISA-N |
| XLogP | 6.60 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.65 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|