C48H56O5Si2 — CID 11592982
tert-butyl-diphenyl-[[(2R,3R,4R,5S,6S)-3,4,5-tris(phenylmethoxy)-6-(2-trimethylsilylethynyl)oxan-2-yl]methoxy]silane (PubChem CID 11592982) has the molecular formula C48H56O5Si2 and a molecular weight of 769.14 g/mol. Its IUPAC name is tert-butyl-diphenyl-[[(2R,3R,4R,5S,6S)-3,4,5-tris(phenylmethoxy)-6-(2-trimethylsilylethynyl)oxan-2-yl]methoxy]silane.
| Compound Name | tert-butyl-diphenyl-[[(2R,3R,4R,5S,6S)-3,4,5-tris(phenylmethoxy)-6-(2-trimethylsilylethynyl)oxan-2-yl]methoxy]silane |
|---|---|
| PubChem CID | 11592982 |
| Molecular Formula | C48H56O5Si2 |
| Molecular Weight | 769.14 g/mol |
| Exact Mass | 768.37 |
| IUPAC Name | tert-butyl-diphenyl-[[(2R,3R,4R,5S,6S)-3,4,5-tris(phenylmethoxy)-6-(2-trimethylsilylethynyl)oxan-2-yl]methoxy]silane |
| SMILES | CC(C)(C)[Si](OC[C@H]1O[C@@H](C#C[Si](C)(C)C)[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H]1OCc1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C48H56O5Si2/c1-48(2,3)55(41-28-18-10-19-29-41,42-30-20-11-21-31-42)52-37-44-46(50-35-39-24-14-8-15-25-39)47(51-36-40-26-16-9-17-27-40)45(43(53-44)32-33-54(4,5)6)49-34-38-22-12-7-13-23-38/h7-31,43-47H,34-37H2,1-6H3/t43-,44+,45-,46+,47+/m0/s1 |
| InChIKey | UULXNDMNSHXXIL-HPKFTWFJSA-N |
| XLogP | 8.97 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 769.14 |
| LogP ≤ 5 | 8.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|