C34H42O3Si2 — CID 10907791
tert-butyl-diphenyl-[[(2S,3R,6S)-6-phenylmethoxy-2-(2-trimethylsilylethynyl)-2,3,6,7-tetrahydrooxepin-3-yl]oxy]silane (PubChem CID 10907791) has the molecular formula C34H42O3Si2 and a molecular weight of 554.88 g/mol. Its IUPAC name is tert-butyl-diphenyl-[[(2S,3R,6S)-6-phenylmethoxy-2-(2-trimethylsilylethynyl)-2,3,6,7-tetrahydrooxepin-3-yl]oxy]silane.
| Compound Name | tert-butyl-diphenyl-[[(2S,3R,6S)-6-phenylmethoxy-2-(2-trimethylsilylethynyl)-2,3,6,7-tetrahydrooxepin-3-yl]oxy]silane |
|---|---|
| PubChem CID | 10907791 |
| Molecular Formula | C34H42O3Si2 |
| Molecular Weight | 554.88 g/mol |
| Exact Mass | 554.27 |
| IUPAC Name | tert-butyl-diphenyl-[[(2S,3R,6S)-6-phenylmethoxy-2-(2-trimethylsilylethynyl)-2,3,6,7-tetrahydrooxepin-3-yl]oxy]silane |
| SMILES | CC(C)(C)[Si](O[C@@H]1C=C[C@H](OCc2ccccc2)CO[C@H]1C#C[Si](C)(C)C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C34H42O3Si2/c1-34(2,3)39(30-18-12-8-13-19-30,31-20-14-9-15-21-31)37-33-23-22-29(35-26-28-16-10-7-11-17-28)27-36-32(33)24-25-38(4,5)6/h7-23,29,32-33H,26-27H2,1-6H3/t29-,32-,33+/m0/s1 |
| InChIKey | ZBCOQHPDRTVNPI-QPWONNCLSA-N |
| XLogP | 6.35 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.88 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|