C29H38O4Si2 — CID 11730884
[(2R,3R,6S)-3-[tert-butyl(diphenyl)silyl]oxy-2-(2-trimethylsilylethynyl)-3,6-dihydro-2H-pyran-6-yl]methyl acetate (PubChem CID 11730884) has the molecular formula C29H38O4Si2 and a molecular weight of 506.79 g/mol. Its IUPAC name is [(2R,3R,6S)-3-[tert-butyl(diphenyl)silyl]oxy-2-(2-trimethylsilylethynyl)-3,6-dihydro-2H-pyran-6-yl]methyl acetate.
| Compound Name | [(2R,3R,6S)-3-[tert-butyl(diphenyl)silyl]oxy-2-(2-trimethylsilylethynyl)-3,6-dihydro-2H-pyran-6-yl]methyl acetate |
|---|---|
| PubChem CID | 11730884 |
| Molecular Formula | C29H38O4Si2 |
| Molecular Weight | 506.79 g/mol |
| Exact Mass | 506.23 |
| IUPAC Name | [(2R,3R,6S)-3-[tert-butyl(diphenyl)silyl]oxy-2-(2-trimethylsilylethynyl)-3,6-dihydro-2H-pyran-6-yl]methyl acetate |
| SMILES | CC(=O)OC[C@@H]1C=C[C@@H](O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@@H](C#C[Si](C)(C)C)O1 |
| InChI | InChI=1S/C29H38O4Si2/c1-23(30)31-22-24-18-19-28(27(32-24)20-21-34(5,6)7)33-35(29(2,3)4,25-14-10-8-11-15-25)26-16-12-9-13-17-26/h8-19,24,27-28H,22H2,1-7H3/t24-,27+,28+/m0/s1 |
| InChIKey | IZVLGIMJJQJKMM-HNPKZYAISA-N |
| XLogP | 4.70 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.79 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|