C29H33FO3S2Si — CID 153333214
[(2R,3S)-3-[tert-butyl(diphenyl)silyl]oxy-5-(4-fluorophenyl)sulfanylthiolan-2-yl]methyl acetate (PubChem CID 153333214) has the molecular formula C29H33FO3S2Si and a molecular weight of 540.80 g/mol. Its IUPAC name is [(2R,3S)-3-[tert-butyl(diphenyl)silyl]oxy-5-(4-fluorophenyl)sulfanylthiolan-2-yl]methyl acetate.
| Compound Name | [(2R,3S)-3-[tert-butyl(diphenyl)silyl]oxy-5-(4-fluorophenyl)sulfanylthiolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 153333214 |
| Molecular Formula | C29H33FO3S2Si |
| Molecular Weight | 540.80 g/mol |
| Exact Mass | 540.16 |
| IUPAC Name | [(2R,3S)-3-[tert-butyl(diphenyl)silyl]oxy-5-(4-fluorophenyl)sulfanylthiolan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1SC(Sc2ccc(F)cc2)C[C@@H]1O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C29H33FO3S2Si/c1-21(31)32-20-27-26(19-28(35-27)34-23-17-15-22(30)16-18-23)33-36(29(2,3)4,24-11-7-5-8-12-24)25-13-9-6-10-14-25/h5-18,26-28H,19-20H2,1-4H3/t26-,27+,28?/m0/s1 |
| InChIKey | CTRSBYZTDZZXCX-MDEZFMAYSA-N |
| XLogP | 6.26 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.80 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|