C26H34O5Si — CID 10939389
2-[(2R,3S,5R)-3-[tert-butyl(diphenyl)silyl]oxy-5-methoxyoxolan-2-yl]prop-2-enyl acetate (PubChem CID 10939389) has the molecular formula C26H34O5Si and a molecular weight of 454.64 g/mol. Its IUPAC name is 2-[(2R,3S,5R)-3-[tert-butyl(diphenyl)silyl]oxy-5-methoxyoxolan-2-yl]prop-2-enyl acetate.
| Compound Name | 2-[(2R,3S,5R)-3-[tert-butyl(diphenyl)silyl]oxy-5-methoxyoxolan-2-yl]prop-2-enyl acetate |
|---|---|
| PubChem CID | 10939389 |
| Molecular Formula | C26H34O5Si |
| Molecular Weight | 454.64 g/mol |
| Exact Mass | 454.22 |
| IUPAC Name | 2-[(2R,3S,5R)-3-[tert-butyl(diphenyl)silyl]oxy-5-methoxyoxolan-2-yl]prop-2-enyl acetate |
| SMILES | C=C(COC(C)=O)[C@H]1O[C@@H](OC)C[C@@H]1O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C26H34O5Si/c1-19(18-29-20(2)27)25-23(17-24(28-6)30-25)31-32(26(3,4)5,21-13-9-7-10-14-21)22-15-11-8-12-16-22/h7-16,23-25H,1,17-18H2,2-6H3/t23-,24+,25+/m0/s1 |
| InChIKey | UHHKWJHIHKLXJL-ISJGIBHGSA-N |
| XLogP | 3.81 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.64 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|