C28H34O6Si — CID 11340896
2-[(5S)-2-(acetyloxymethyl)-5-[tert-butyl(diphenyl)silyl]oxy-3-oxocyclopenten-1-yl]ethyl acetate (PubChem CID 11340896) has the molecular formula C28H34O6Si and a molecular weight of 494.66 g/mol. Its IUPAC name is 2-[(5S)-2-(acetyloxymethyl)-5-[tert-butyl(diphenyl)silyl]oxy-3-oxocyclopenten-1-yl]ethyl acetate.
| Compound Name | 2-[(5S)-2-(acetyloxymethyl)-5-[tert-butyl(diphenyl)silyl]oxy-3-oxocyclopenten-1-yl]ethyl acetate |
|---|---|
| PubChem CID | 11340896 |
| Molecular Formula | C28H34O6Si |
| Molecular Weight | 494.66 g/mol |
| Exact Mass | 494.21 |
| IUPAC Name | 2-[(5S)-2-(acetyloxymethyl)-5-[tert-butyl(diphenyl)silyl]oxy-3-oxocyclopenten-1-yl]ethyl acetate |
| SMILES | CC(=O)OCCC1=C(COC(C)=O)C(=O)C[C@@H]1O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C28H34O6Si/c1-20(29)32-17-16-24-25(19-33-21(2)30)26(31)18-27(24)34-35(28(3,4)5,22-12-8-6-9-13-22)23-14-10-7-11-15-23/h6-15,27H,16-19H2,1-5H3/t27-/m0/s1 |
| InChIKey | KRIMTIRUYPYEIF-MHZLTWQESA-N |
| XLogP | 3.72 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.66 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|