C27H34O4Si — CID 89187762
ethyl (2E)-2-[(3R)-3-[tert-butyl(diphenyl)silyl]oxy-5-hydroxy-4-methylidenecyclohexylidene]acetate (PubChem CID 89187762) has the molecular formula C27H34O4Si and a molecular weight of 450.65 g/mol. Its IUPAC name is ethyl (2E)-2-[(3R)-3-[tert-butyl(diphenyl)silyl]oxy-5-hydroxy-4-methylidenecyclohexylidene]acetate.
| Compound Name | ethyl (2E)-2-[(3R)-3-[tert-butyl(diphenyl)silyl]oxy-5-hydroxy-4-methylidenecyclohexylidene]acetate |
|---|---|
| PubChem CID | 89187762 |
| Molecular Formula | C27H34O4Si |
| Molecular Weight | 450.65 g/mol |
| Exact Mass | 450.22 |
| IUPAC Name | ethyl (2E)-2-[(3R)-3-[tert-butyl(diphenyl)silyl]oxy-5-hydroxy-4-methylidenecyclohexylidene]acetate |
| SMILES | C=C1C(O)C/C(=C\C(=O)OCC)C[C@H]1O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C27H34O4Si/c1-6-30-26(29)19-21-17-24(28)20(2)25(18-21)31-32(27(3,4)5,22-13-9-7-10-14-22)23-15-11-8-12-16-23/h7-16,19,24-25,28H,2,6,17-18H2,1,3-5H3/b21-19+/t24?,25-/m1/s1 |
| InChIKey | NBPGIEXTULBXPI-KRUWYHBYSA-N |
| XLogP | 4.13 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.65 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|