C11H16O2 — CID 59093977
ethyl 2-[(1R,5S)-3-bicyclo[3.2.0]heptanylidene]acetate (PubChem CID 59093977) has the molecular formula C11H16O2 and a molecular weight of 180.25 g/mol. Its IUPAC name is ethyl 2-[(1R,5S)-3-bicyclo[3.2.0]heptanylidene]acetate.
| Compound Name | ethyl 2-[(1R,5S)-3-bicyclo[3.2.0]heptanylidene]acetate |
|---|---|
| PubChem CID | 59093977 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | ethyl 2-[(1R,5S)-3-bicyclo[3.2.0]heptanylidene]acetate |
| SMILES | CCOC(=O)/C=C1\C[C@H]2CC[C@H]2C1 |
| InChI | InChI=1S/C11H16O2/c1-2-13-11(12)7-8-5-9-3-4-10(9)6-8/h7,9-10H,2-6H2,1H3/b8-7-/t9-,10+/m0/s1 |
| InChIKey | GQIWNASFZGOAHS-ZTXJHGQBSA-N |
| XLogP | 2.30 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|