About ethyl 2-(1,1-dihydroxythian-4-ylidene)acetate
ethyl 2-(1,1-dihydroxythian-4-ylidene)acetate (PubChem CID 130201775) has the molecular formula C9H16O4S
and a molecular weight of 220.29 g/mol. Its IUPAC name is ethyl 2-(1,1-dihydroxythian-4-ylidene)acetate.
Molecular Properties
| Compound Name | ethyl 2-(1,1-dihydroxythian-4-ylidene)acetate |
| PubChem CID | 130201775 |
| Molecular Formula | C9H16O4S |
| Molecular Weight | 220.29 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | ethyl 2-(1,1-dihydroxythian-4-ylidene)acetate |
| SMILES | CCOC(=O)C=C1CCS(O)(O)CC1 |
| InChI | InChI=1S/C9H16O4S/c1-2-13-9(10)7-8-3-5-14(11,12)6-4-8/h7,11-12H,2-6H2,1H3 |
| InChIKey | JCOYBTLVMFVKCZ-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.29 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-(1,1-dihydroxythian-4-ylidene)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-(1,1-dihydroxythian-4-ylidene)acetate?
The IUPAC name of ethyl 2-(1,1-dihydroxythian-4-ylidene)acetate (CID 130201775) is ethyl 2-(1,1-dihydroxythian-4-ylidene)acetate.
What is the SMILES notation for ethyl 2-(1,1-dihydroxythian-4-ylidene)acetate?
The canonical SMILES for ethyl 2-(1,1-dihydroxythian-4-ylidene)acetate is CCOC(=O)C=C1CCS(O)(O)CC1.
What is the InChIKey of ethyl 2-(1,1-dihydroxythian-4-ylidene)acetate?
The InChIKey is JCOYBTLVMFVKCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O4S/c1-2-13-9(10)7-8-3-5-14(11,12)6-4-8/h7,11-12H,2-6H2,1H3.
What are the key properties of ethyl 2-(1,1-dihydroxythian-4-ylidene)acetate?
ethyl 2-(1,1-dihydroxythian-4-ylidene)acetate has a molecular weight of 220.29 g/mol, XLogP of 2.02, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(1,1-dihydroxythian-4-ylidene)acetate is sourced from PubChem (CID 130201775), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).