About 2-cyclobutylideneethanol;ethyl 2-cyclobutylideneacetate;methane
2-cyclobutylideneethanol;ethyl 2-cyclobutylideneacetate;methane (PubChem CID 159790396) has the molecular formula C15H26O3
and a molecular weight of 254.37 g/mol. Its IUPAC name is 2-cyclobutylideneethanol;ethyl 2-cyclobutylideneacetate;methane.
Molecular Properties
| Compound Name | 2-cyclobutylideneethanol;ethyl 2-cyclobutylideneacetate;methane |
| PubChem CID | 159790396 |
| Molecular Formula | C15H26O3 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.19 |
| IUPAC Name | 2-cyclobutylideneethanol;ethyl 2-cyclobutylideneacetate;methane |
| SMILES | C.CCOC(=O)C=C1CCC1.OCC=C1CCC1 |
| InChI | InChI=1S/C8H12O2.C6H10O.CH4/c1-2-10-8(9)6-7-4-3-5-7;7-5-4-6-2-1-3-6;/h6H,2-5H2,1H3;4,7H,1-3,5H2;1H4 |
| InChIKey | NIMFWAANUWHMKY-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-cyclobutylideneethanol;ethyl 2-cyclobutylideneacetate;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclobutylideneethanol;ethyl 2-cyclobutylideneacetate;methane?
The IUPAC name of 2-cyclobutylideneethanol;ethyl 2-cyclobutylideneacetate;methane (CID 159790396) is 2-cyclobutylideneethanol;ethyl 2-cyclobutylideneacetate;methane.
What is the SMILES notation for 2-cyclobutylideneethanol;ethyl 2-cyclobutylideneacetate;methane?
The canonical SMILES for 2-cyclobutylideneethanol;ethyl 2-cyclobutylideneacetate;methane is C.CCOC(=O)C=C1CCC1.OCC=C1CCC1.
What is the InChIKey of 2-cyclobutylideneethanol;ethyl 2-cyclobutylideneacetate;methane?
The InChIKey is NIMFWAANUWHMKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12O2.C6H10O.CH4/c1-2-10-8(9)6-7-4-3-5-7;7-5-4-6-2-1-3-6;/h6H,2-5H2,1H3;4,7H,1-3,5H2;1H4.
What are the key properties of 2-cyclobutylideneethanol;ethyl 2-cyclobutylideneacetate;methane?
2-cyclobutylideneethanol;ethyl 2-cyclobutylideneacetate;methane has a molecular weight of 254.37 g/mol, XLogP of 3.38, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclobutylideneethanol;ethyl 2-cyclobutylideneacetate;methane is sourced from PubChem (CID 159790396), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).