C30H34O3Si — CID 102311250
ethyl 7-[tert-butyl(diphenyl)silyl]oxy-8,9-dihydro-7H-benzo[7]annulene-6-carboxylate (PubChem CID 102311250) has the molecular formula C30H34O3Si and a molecular weight of 470.69 g/mol. Its IUPAC name is ethyl 7-[tert-butyl(diphenyl)silyl]oxy-8,9-dihydro-7H-benzo[7]annulene-6-carboxylate.
| Compound Name | ethyl 7-[tert-butyl(diphenyl)silyl]oxy-8,9-dihydro-7H-benzo[7]annulene-6-carboxylate |
|---|---|
| PubChem CID | 102311250 |
| Molecular Formula | C30H34O3Si |
| Molecular Weight | 470.69 g/mol |
| Exact Mass | 470.23 |
| IUPAC Name | ethyl 7-[tert-butyl(diphenyl)silyl]oxy-8,9-dihydro-7H-benzo[7]annulene-6-carboxylate |
| SMILES | CCOC(=O)C1=Cc2ccccc2CCC1O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C30H34O3Si/c1-5-32-29(31)27-22-24-15-13-12-14-23(24)20-21-28(27)33-34(30(2,3)4,25-16-8-6-9-17-25)26-18-10-7-11-19-26/h6-19,22,28H,5,20-21H2,1-4H3 |
| InChIKey | ZSZWIFPEIRFDSZ-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.69 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|