C27H30ClNO3Si — CID 140845775
[(1R,2R)-1-[tert-butyl(diphenyl)silyl]oxy-8-chloro-1,2,3,4-tetrahydronaphthalen-2-yl] carbamate (PubChem CID 140845775) has the molecular formula C27H30ClNO3Si and a molecular weight of 480.08 g/mol. Its IUPAC name is [(1R,2R)-1-[tert-butyl(diphenyl)silyl]oxy-8-chloro-1,2,3,4-tetrahydronaphthalen-2-yl] carbamate.
| Compound Name | [(1R,2R)-1-[tert-butyl(diphenyl)silyl]oxy-8-chloro-1,2,3,4-tetrahydronaphthalen-2-yl] carbamate |
|---|---|
| PubChem CID | 140845775 |
| Molecular Formula | C27H30ClNO3Si |
| Molecular Weight | 480.08 g/mol |
| Exact Mass | 479.17 |
| IUPAC Name | [(1R,2R)-1-[tert-butyl(diphenyl)silyl]oxy-8-chloro-1,2,3,4-tetrahydronaphthalen-2-yl] carbamate |
| SMILES | CC(C)(C)[Si](O[C@@H]1c2c(Cl)cccc2CC[C@H]1OC(N)=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H30ClNO3Si/c1-27(2,3)33(20-12-6-4-7-13-20,21-14-8-5-9-15-21)32-25-23(31-26(29)30)18-17-19-11-10-16-22(28)24(19)25/h4-16,23,25H,17-18H2,1-3H3,(H2,29,30)/t23-,25+/m1/s1 |
| InChIKey | FOJKNQQUKUPHLB-NOZRDPDXSA-N |
| XLogP | 5.37 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.08 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|