C26H28ClNO3Si — CID 140845764
[(1S,2S)-1-[tert-butyl(diphenyl)silyl]oxy-7-chloro-2,3-dihydro-1H-inden-2-yl] carbamate (PubChem CID 140845764) has the molecular formula C26H28ClNO3Si and a molecular weight of 466.05 g/mol. Its IUPAC name is [(1S,2S)-1-[tert-butyl(diphenyl)silyl]oxy-7-chloro-2,3-dihydro-1H-inden-2-yl] carbamate.
| Compound Name | [(1S,2S)-1-[tert-butyl(diphenyl)silyl]oxy-7-chloro-2,3-dihydro-1H-inden-2-yl] carbamate |
|---|---|
| PubChem CID | 140845764 |
| Molecular Formula | C26H28ClNO3Si |
| Molecular Weight | 466.05 g/mol |
| Exact Mass | 465.15 |
| IUPAC Name | [(1S,2S)-1-[tert-butyl(diphenyl)silyl]oxy-7-chloro-2,3-dihydro-1H-inden-2-yl] carbamate |
| SMILES | CC(C)(C)[Si](O[C@H]1c2c(Cl)cccc2C[C@@H]1OC(N)=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H28ClNO3Si/c1-26(2,3)32(19-12-6-4-7-13-19,20-14-8-5-9-15-20)31-24-22(30-25(28)29)17-18-11-10-16-21(27)23(18)24/h4-16,22,24H,17H2,1-3H3,(H2,28,29)/t22-,24+/m0/s1 |
| InChIKey | YIODSNZVYBECRQ-LADGPHEKSA-N |
| XLogP | 4.98 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.05 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|