C25H25ClOSi — CID 140845766
tert-butyl-[(7-chloro-3H-inden-1-yl)oxy]-diphenylsilane (PubChem CID 140845766) has the molecular formula C25H25ClOSi and a molecular weight of 405.01 g/mol. Its IUPAC name is tert-butyl-[(7-chloro-3H-inden-1-yl)oxy]-diphenylsilane.
| Compound Name | tert-butyl-[(7-chloro-3H-inden-1-yl)oxy]-diphenylsilane |
|---|---|
| PubChem CID | 140845766 |
| Molecular Formula | C25H25ClOSi |
| Molecular Weight | 405.01 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | tert-butyl-[(7-chloro-3H-inden-1-yl)oxy]-diphenylsilane |
| SMILES | CC(C)(C)[Si](OC1=CCc2cccc(Cl)c21)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H25ClOSi/c1-25(2,3)28(20-12-6-4-7-13-20,21-14-8-5-9-15-21)27-23-18-17-19-11-10-16-22(26)24(19)23/h4-16,18H,17H2,1-3H3 |
| InChIKey | LDDOECVDPWCXNJ-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.01 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|