C28H30O3Si — CID 70270383
9-[tert-butyl(diphenyl)silyl]oxy-8,9-dihydro-5H-benzo[7]annulene-6-carboxylic acid (PubChem CID 70270383) has the molecular formula C28H30O3Si and a molecular weight of 442.63 g/mol. Its IUPAC name is 9-[tert-butyl(diphenyl)silyl]oxy-8,9-dihydro-5H-benzo[7]annulene-6-carboxylic acid.
| Compound Name | 9-[tert-butyl(diphenyl)silyl]oxy-8,9-dihydro-5H-benzo[7]annulene-6-carboxylic acid |
|---|---|
| PubChem CID | 70270383 |
| Molecular Formula | C28H30O3Si |
| Molecular Weight | 442.63 g/mol |
| Exact Mass | 442.20 |
| IUPAC Name | 9-[tert-butyl(diphenyl)silyl]oxy-8,9-dihydro-5H-benzo[7]annulene-6-carboxylic acid |
| SMILES | CC(C)(C)[Si](OC1CC=C(C(=O)O)Cc2ccccc21)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H30O3Si/c1-28(2,3)32(23-13-6-4-7-14-23,24-15-8-5-9-16-24)31-26-19-18-22(27(29)30)20-21-12-10-11-17-25(21)26/h4-18,26H,19-20H2,1-3H3,(H,29,30) |
| InChIKey | UFUUOBFRTQDUJV-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.63 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|