C30H38N2O3SSi — CID 71608774
1-[(1S,2R)-2-[tert-butyl(diphenyl)silyl]oxy-2,3-dihydro-1H-inden-1-yl]-3-[(R)-tert-butylsulfinyl]urea (PubChem CID 71608774) has the molecular formula C30H38N2O3SSi and a molecular weight of 534.80 g/mol. Its IUPAC name is 1-[(1S,2R)-2-[tert-butyl(diphenyl)silyl]oxy-2,3-dihydro-1H-inden-1-yl]-3-[(R)-tert-butylsulfinyl]urea.
| Compound Name | 1-[(1S,2R)-2-[tert-butyl(diphenyl)silyl]oxy-2,3-dihydro-1H-inden-1-yl]-3-[(R)-tert-butylsulfinyl]urea |
|---|---|
| PubChem CID | 71608774 |
| Molecular Formula | C30H38N2O3SSi |
| Molecular Weight | 534.80 g/mol |
| Exact Mass | 534.24 |
| IUPAC Name | 1-[(1S,2R)-2-[tert-butyl(diphenyl)silyl]oxy-2,3-dihydro-1H-inden-1-yl]-3-[(R)-tert-butylsulfinyl]urea |
| SMILES | CC(C)(C)[S@@](=O)NC(=O)N[C@H]1c2ccccc2C[C@H]1O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C30H38N2O3SSi/c1-29(2,3)36(34)32-28(33)31-27-25-20-14-13-15-22(25)21-26(27)35-37(30(4,5)6,23-16-9-7-10-17-23)24-18-11-8-12-19-24/h7-20,26-27H,21H2,1-6H3,(H2,31,32,33)/t26-,27+,36-/m1/s1 |
| InChIKey | MWBHLVICWWLWBA-IGHHUVOLSA-N |
| XLogP | 4.99 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.80 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|