C25H37NO3SSi — CID 165411713
N-[4-[tert-butyl(diphenyl)silyl]oxy-3-methyloxolan-3-yl]-2-methylpropane-2-sulfinamide (PubChem CID 165411713) has the molecular formula C25H37NO3SSi and a molecular weight of 459.73 g/mol. Its IUPAC name is N-[4-[tert-butyl(diphenyl)silyl]oxy-3-methyloxolan-3-yl]-2-methylpropane-2-sulfinamide.
| Compound Name | N-[4-[tert-butyl(diphenyl)silyl]oxy-3-methyloxolan-3-yl]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 165411713 |
| Molecular Formula | C25H37NO3SSi |
| Molecular Weight | 459.73 g/mol |
| Exact Mass | 459.23 |
| IUPAC Name | N-[4-[tert-butyl(diphenyl)silyl]oxy-3-methyloxolan-3-yl]-2-methylpropane-2-sulfinamide |
| SMILES | CC1(NS(=O)C(C)(C)C)COCC1O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C25H37NO3SSi/c1-23(2,3)30(27)26-25(7)19-28-18-22(25)29-31(24(4,5)6,20-14-10-8-11-15-20)21-16-12-9-13-17-21/h8-17,22,26H,18-19H2,1-7H3 |
| InChIKey | KJVQOOUTUOEVFQ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.73 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|