C31H41NO2SSi — CID 178086838
N-[3-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-phenylcyclobutyl]-2-methylpropane-2-sulfinamide (PubChem CID 178086838) has the molecular formula C31H41NO2SSi and a molecular weight of 519.83 g/mol. Its IUPAC name is N-[3-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-phenylcyclobutyl]-2-methylpropane-2-sulfinamide.
| Compound Name | N-[3-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-phenylcyclobutyl]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 178086838 |
| Molecular Formula | C31H41NO2SSi |
| Molecular Weight | 519.83 g/mol |
| Exact Mass | 519.26 |
| IUPAC Name | N-[3-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-phenylcyclobutyl]-2-methylpropane-2-sulfinamide |
| SMILES | CC(C)(C)S(=O)NC1(c2ccccc2)CC(CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C1 |
| InChI | InChI=1S/C31H41NO2SSi/c1-29(2,3)35(33)32-31(26-16-10-7-11-17-26)22-25(23-31)24-34-36(30(4,5)6,27-18-12-8-13-19-27)28-20-14-9-15-21-28/h7-21,25,32H,22-24H2,1-6H3 |
| InChIKey | PXFMCDAAQMYQSN-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.83 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|