C29H39NO2SSi — CID 102290514
N-[(2R)-1-[tert-butyl(diphenyl)silyl]oxy-2-phenylpropan-2-yl]-2-methylpropane-2-sulfinamide (PubChem CID 102290514) has the molecular formula C29H39NO2SSi and a molecular weight of 493.79 g/mol. Its IUPAC name is N-[(2R)-1-[tert-butyl(diphenyl)silyl]oxy-2-phenylpropan-2-yl]-2-methylpropane-2-sulfinamide.
| Compound Name | N-[(2R)-1-[tert-butyl(diphenyl)silyl]oxy-2-phenylpropan-2-yl]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 102290514 |
| Molecular Formula | C29H39NO2SSi |
| Molecular Weight | 493.79 g/mol |
| Exact Mass | 493.25 |
| IUPAC Name | N-[(2R)-1-[tert-butyl(diphenyl)silyl]oxy-2-phenylpropan-2-yl]-2-methylpropane-2-sulfinamide |
| SMILES | CC(C)(C)S(=O)N[C@@](C)(CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C29H39NO2SSi/c1-27(2,3)33(31)30-29(7,24-17-11-8-12-18-24)23-32-34(28(4,5)6,25-19-13-9-14-20-25)26-21-15-10-16-22-26/h8-22,30H,23H2,1-7H3/t29-,33?/m0/s1 |
| InChIKey | DDQTZNCFLSHOBE-WXTKOERCSA-N |
| XLogP | 5.53 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.79 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|