C23H34FNOSi — CID 172785843
(2R)-3-[tert-butyl(diphenyl)silyl]oxy-2-fluoro-2-methyl-N-propan-2-ylpropan-1-amine (PubChem CID 172785843) has the molecular formula C23H34FNOSi and a molecular weight of 387.62 g/mol. Its IUPAC name is (2R)-3-[tert-butyl(diphenyl)silyl]oxy-2-fluoro-2-methyl-N-propan-2-ylpropan-1-amine.
| Compound Name | (2R)-3-[tert-butyl(diphenyl)silyl]oxy-2-fluoro-2-methyl-N-propan-2-ylpropan-1-amine |
|---|---|
| PubChem CID | 172785843 |
| Molecular Formula | C23H34FNOSi |
| Molecular Weight | 387.62 g/mol |
| Exact Mass | 387.24 |
| IUPAC Name | (2R)-3-[tert-butyl(diphenyl)silyl]oxy-2-fluoro-2-methyl-N-propan-2-ylpropan-1-amine |
| SMILES | CC(C)NC[C@@](C)(F)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C23H34FNOSi/c1-19(2)25-17-23(6,24)18-26-27(22(3,4)5,20-13-9-7-10-14-20)21-15-11-8-12-16-21/h7-16,19,25H,17-18H2,1-6H3/t23-/m1/s1 |
| InChIKey | OWLQPTZLBNVANS-HSZRJFAPSA-N |
| XLogP | 4.29 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.62 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|