C31H39FN2OSi — CID 140830259
3-[tert-butyl(diphenyl)silyl]oxy-2-fluoro-N-[(2R)-1-indol-1-ylpropan-2-yl]-2-methylpropan-1-amine (PubChem CID 140830259) has the molecular formula C31H39FN2OSi and a molecular weight of 502.75 g/mol. Its IUPAC name is 3-[tert-butyl(diphenyl)silyl]oxy-2-fluoro-N-[(2R)-1-indol-1-ylpropan-2-yl]-2-methylpropan-1-amine.
| Compound Name | 3-[tert-butyl(diphenyl)silyl]oxy-2-fluoro-N-[(2R)-1-indol-1-ylpropan-2-yl]-2-methylpropan-1-amine |
|---|---|
| PubChem CID | 140830259 |
| Molecular Formula | C31H39FN2OSi |
| Molecular Weight | 502.75 g/mol |
| Exact Mass | 502.28 |
| IUPAC Name | 3-[tert-butyl(diphenyl)silyl]oxy-2-fluoro-N-[(2R)-1-indol-1-ylpropan-2-yl]-2-methylpropan-1-amine |
| SMILES | C[C@H](Cn1ccc2ccccc21)NCC(C)(F)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C31H39FN2OSi/c1-25(22-34-21-20-26-14-12-13-19-29(26)34)33-23-31(5,32)24-35-36(30(2,3)4,27-15-8-6-9-16-27)28-17-10-7-11-18-28/h6-21,25,33H,22-24H2,1-5H3/t25-,31?/m1/s1 |
| InChIKey | XXZNHDHEKFJXKW-KZQYXEPFSA-N |
| XLogP | 5.92 |
| TPSA | 26.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.75 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|