C19H24F2O2Si — CID 125483258
3-[tert-butyl(diphenyl)silyl]oxy-2,2-difluoropropan-1-ol (PubChem CID 125483258) has the molecular formula C19H24F2O2Si and a molecular weight of 350.48 g/mol. Its IUPAC name is 3-[tert-butyl(diphenyl)silyl]oxy-2,2-difluoropropan-1-ol.
| Compound Name | 3-[tert-butyl(diphenyl)silyl]oxy-2,2-difluoropropan-1-ol |
|---|---|
| PubChem CID | 125483258 |
| Molecular Formula | C19H24F2O2Si |
| Molecular Weight | 350.48 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | 3-[tert-butyl(diphenyl)silyl]oxy-2,2-difluoropropan-1-ol |
| SMILES | CC(C)(C)[Si](OCC(F)(F)CO)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H24F2O2Si/c1-18(2,3)24(16-10-6-4-7-11-16,17-12-8-5-9-13-17)23-15-19(20,21)14-22/h4-13,22H,14-15H2,1-3H3 |
| InChIKey | DPTVIASBQRUVNA-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.48 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|