C22H29F3O3Si — CID 175998383
2-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-(trifluoromethyl)butane-1,4-diol (PubChem CID 175998383) has the molecular formula C22H29F3O3Si and a molecular weight of 426.55 g/mol. Its IUPAC name is 2-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-(trifluoromethyl)butane-1,4-diol.
| Compound Name | 2-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-(trifluoromethyl)butane-1,4-diol |
|---|---|
| PubChem CID | 175998383 |
| Molecular Formula | C22H29F3O3Si |
| Molecular Weight | 426.55 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | 2-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-(trifluoromethyl)butane-1,4-diol |
| SMILES | CC(C)(C)[Si](OCC(CO)(CCO)C(F)(F)F)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H29F3O3Si/c1-20(2,3)29(18-10-6-4-7-11-18,19-12-8-5-9-13-19)28-17-21(16-27,14-15-26)22(23,24)25/h4-13,26-27H,14-17H2,1-3H3 |
| InChIKey | HINGWQJKPHTWMX-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.55 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|