C41H53FO3Si2 — CID 142348320
8-[tert-butyl(diphenyl)silyl]oxy-7-[[tert-butyl(diphenyl)silyl]oxymethyl]-7-fluorooctan-2-one (PubChem CID 142348320) has the molecular formula C41H53FO3Si2 and a molecular weight of 669.04 g/mol. Its IUPAC name is 8-[tert-butyl(diphenyl)silyl]oxy-7-[[tert-butyl(diphenyl)silyl]oxymethyl]-7-fluorooctan-2-one.
| Compound Name | 8-[tert-butyl(diphenyl)silyl]oxy-7-[[tert-butyl(diphenyl)silyl]oxymethyl]-7-fluorooctan-2-one |
|---|---|
| PubChem CID | 142348320 |
| Molecular Formula | C41H53FO3Si2 |
| Molecular Weight | 669.04 g/mol |
| Exact Mass | 668.35 |
| IUPAC Name | 8-[tert-butyl(diphenyl)silyl]oxy-7-[[tert-butyl(diphenyl)silyl]oxymethyl]-7-fluorooctan-2-one |
| SMILES | CC(=O)CCCCC(F)(CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C41H53FO3Si2/c1-34(43)22-20-21-31-41(42,32-44-46(39(2,3)4,35-23-12-8-13-24-35)36-25-14-9-15-26-36)33-45-47(40(5,6)7,37-27-16-10-17-28-37)38-29-18-11-19-30-38/h8-19,23-30H,20-22,31-33H2,1-7H3 |
| InChIKey | FBEJWRRCEUBXDD-UHFFFAOYSA-N |
| XLogP | 8.00 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.04 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|