C28H35F2NO2Si — CID 156894869
3-[(2R)-2-[[3-[tert-butyl(diphenyl)silyl]oxy-2,2-difluoropropyl]amino]propyl]phenol (PubChem CID 156894869) has the molecular formula C28H35F2NO2Si and a molecular weight of 483.68 g/mol. Its IUPAC name is 3-[(2R)-2-[[3-[tert-butyl(diphenyl)silyl]oxy-2,2-difluoropropyl]amino]propyl]phenol.
| Compound Name | 3-[(2R)-2-[[3-[tert-butyl(diphenyl)silyl]oxy-2,2-difluoropropyl]amino]propyl]phenol |
|---|---|
| PubChem CID | 156894869 |
| Molecular Formula | C28H35F2NO2Si |
| Molecular Weight | 483.68 g/mol |
| Exact Mass | 483.24 |
| IUPAC Name | 3-[(2R)-2-[[3-[tert-butyl(diphenyl)silyl]oxy-2,2-difluoropropyl]amino]propyl]phenol |
| SMILES | C[C@H](Cc1cccc(O)c1)NCC(F)(F)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C28H35F2NO2Si/c1-22(18-23-12-11-13-24(32)19-23)31-20-28(29,30)21-33-34(27(2,3)4,25-14-7-5-8-15-25)26-16-9-6-10-17-26/h5-17,19,22,31-32H,18,20-21H2,1-4H3/t22-/m1/s1 |
| InChIKey | AIEICIFQVKORBX-JOCHJYFZSA-N |
| XLogP | 5.12 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.68 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|