C34H42F2N2O2Si — CID 174234185
3-[tert-butyl(diphenyl)silyl]oxy-N-[1-[6-(cyclopropylmethoxy)-1H-indol-3-yl]propan-2-yl]-2,2-difluoropropan-1-amine (PubChem CID 174234185) has the molecular formula C34H42F2N2O2Si and a molecular weight of 576.80 g/mol. Its IUPAC name is 3-[tert-butyl(diphenyl)silyl]oxy-N-[1-[6-(cyclopropylmethoxy)-1H-indol-3-yl]propan-2-yl]-2,2-difluoropropan-1-amine.
| Compound Name | 3-[tert-butyl(diphenyl)silyl]oxy-N-[1-[6-(cyclopropylmethoxy)-1H-indol-3-yl]propan-2-yl]-2,2-difluoropropan-1-amine |
|---|---|
| PubChem CID | 174234185 |
| Molecular Formula | C34H42F2N2O2Si |
| Molecular Weight | 576.80 g/mol |
| Exact Mass | 576.30 |
| IUPAC Name | 3-[tert-butyl(diphenyl)silyl]oxy-N-[1-[6-(cyclopropylmethoxy)-1H-indol-3-yl]propan-2-yl]-2,2-difluoropropan-1-amine |
| SMILES | CC(Cc1c[nH]c2cc(OCC3CC3)ccc12)NCC(F)(F)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C34H42F2N2O2Si/c1-25(19-27-21-37-32-20-28(17-18-31(27)32)39-22-26-15-16-26)38-23-34(35,36)24-40-41(33(2,3)4,29-11-7-5-8-12-29)30-13-9-6-10-14-30/h5-14,17-18,20-21,25-26,37-38H,15-16,19,22-24H2,1-4H3 |
| InChIKey | JGTCUYGARDMCGB-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 46.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.80 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|