C29H33BrFNOSi — CID 170712658
[3-(5-bromo-6-fluoro-1H-indol-3-yl)-2,2-dimethylpropoxy]-tert-butyl-diphenylsilane (PubChem CID 170712658) has the molecular formula C29H33BrFNOSi and a molecular weight of 538.58 g/mol. Its IUPAC name is [3-(5-bromo-6-fluoro-1H-indol-3-yl)-2,2-dimethylpropoxy]-tert-butyl-diphenylsilane.
| Compound Name | [3-(5-bromo-6-fluoro-1H-indol-3-yl)-2,2-dimethylpropoxy]-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 170712658 |
| Molecular Formula | C29H33BrFNOSi |
| Molecular Weight | 538.58 g/mol |
| Exact Mass | 537.15 |
| IUPAC Name | [3-(5-bromo-6-fluoro-1H-indol-3-yl)-2,2-dimethylpropoxy]-tert-butyl-diphenylsilane |
| SMILES | CC(C)(CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)Cc1c[nH]c2cc(F)c(Br)cc12 |
| InChI | InChI=1S/C29H33BrFNOSi/c1-28(2,3)34(22-12-8-6-9-13-22,23-14-10-7-11-15-23)33-20-29(4,5)18-21-19-32-27-17-26(31)25(30)16-24(21)27/h6-17,19,32H,18,20H2,1-5H3 |
| InChIKey | HYMDURWQHSIAME-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 25.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.58 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|