C30H36BrNOSi — CID 176787045
[3-(5-bromo-2-methyl-1H-indol-3-yl)-2,2-dimethylpropoxy]-tert-butyl-diphenylsilane (PubChem CID 176787045) has the molecular formula C30H36BrNOSi and a molecular weight of 534.61 g/mol. Its IUPAC name is [3-(5-bromo-2-methyl-1H-indol-3-yl)-2,2-dimethylpropoxy]-tert-butyl-diphenylsilane.
| Compound Name | [3-(5-bromo-2-methyl-1H-indol-3-yl)-2,2-dimethylpropoxy]-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 176787045 |
| Molecular Formula | C30H36BrNOSi |
| Molecular Weight | 534.61 g/mol |
| Exact Mass | 533.17 |
| IUPAC Name | [3-(5-bromo-2-methyl-1H-indol-3-yl)-2,2-dimethylpropoxy]-tert-butyl-diphenylsilane |
| SMILES | Cc1[nH]c2ccc(Br)cc2c1CC(C)(C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C30H36BrNOSi/c1-22-27(26-19-23(31)17-18-28(26)32-22)20-30(5,6)21-33-34(29(2,3)4,24-13-9-7-10-14-24)25-15-11-8-12-16-25/h7-19,32H,20-21H2,1-6H3 |
| InChIKey | IKYZHIHMOFJPTE-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 25.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.61 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|