C41H50BrN3O3Si — CID 178037188
[3-[5-bromo-2-[2-[(1S)-1-methoxyethyl]-5-morpholin-4-yl-3-pyridinyl]-1H-indol-3-yl]-2,2-dimethylpropoxy]-tert-butyl-diphenylsilane (PubChem CID 178037188) has the molecular formula C41H50BrN3O3Si and a molecular weight of 740.86 g/mol. Its IUPAC name is [3-[5-bromo-2-[2-[(1S)-1-methoxyethyl]-5-morpholin-4-yl-3-pyridinyl]-1H-indol-3-yl]-2,2-dimethylpropoxy]-tert-butyl-diphenylsilane.
| Compound Name | [3-[5-bromo-2-[2-[(1S)-1-methoxyethyl]-5-morpholin-4-yl-3-pyridinyl]-1H-indol-3-yl]-2,2-dimethylpropoxy]-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 178037188 |
| Molecular Formula | C41H50BrN3O3Si |
| Molecular Weight | 740.86 g/mol |
| Exact Mass | 739.28 |
| IUPAC Name | [3-[5-bromo-2-[2-[(1S)-1-methoxyethyl]-5-morpholin-4-yl-3-pyridinyl]-1H-indol-3-yl]-2,2-dimethylpropoxy]-tert-butyl-diphenylsilane |
| SMILES | CO[C@@H](C)c1ncc(N2CCOCC2)cc1-c1[nH]c2ccc(Br)cc2c1CC(C)(C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C41H50BrN3O3Si/c1-29(46-7)38-35(25-31(27-43-38)45-20-22-47-23-21-45)39-36(34-24-30(42)18-19-37(34)44-39)26-41(5,6)28-48-49(40(2,3)4,32-14-10-8-11-15-32)33-16-12-9-13-17-33/h8-19,24-25,27,29,44H,20-23,26,28H2,1-7H3/t29-/m0/s1 |
| InChIKey | RSHOMPPSOITQTH-LJAQVGFWSA-N |
| XLogP | 8.68 |
| TPSA | 59.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.86 |
| LogP ≤ 5 | 8.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|