C28H37N3O4 — CID 156737051
[3-[1-ethyl-2-[2-(1-methoxyethyl)-3-pyridinyl]-5-morpholin-4-ylindol-3-yl]-2,2-dimethylpropyl] formate (PubChem CID 156737051) has the molecular formula C28H37N3O4 and a molecular weight of 479.62 g/mol. Its IUPAC name is [3-[1-ethyl-2-[2-(1-methoxyethyl)-3-pyridinyl]-5-morpholin-4-ylindol-3-yl]-2,2-dimethylpropyl] formate.
| Compound Name | [3-[1-ethyl-2-[2-(1-methoxyethyl)-3-pyridinyl]-5-morpholin-4-ylindol-3-yl]-2,2-dimethylpropyl] formate |
|---|---|
| PubChem CID | 156737051 |
| Molecular Formula | C28H37N3O4 |
| Molecular Weight | 479.62 g/mol |
| Exact Mass | 479.28 |
| IUPAC Name | [3-[1-ethyl-2-[2-(1-methoxyethyl)-3-pyridinyl]-5-morpholin-4-ylindol-3-yl]-2,2-dimethylpropyl] formate |
| SMILES | CCn1c(-c2cccnc2C(C)OC)c(CC(C)(C)COC=O)c2cc(N3CCOCC3)ccc21 |
| InChI | InChI=1S/C28H37N3O4/c1-6-31-25-10-9-21(30-12-14-34-15-13-30)16-23(25)24(17-28(3,4)18-35-19-32)27(31)22-8-7-11-29-26(22)20(2)33-5/h7-11,16,19-20H,6,12-15,17-18H2,1-5H3 |
| InChIKey | UPDQUAZNCDZQLF-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 65.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.62 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|