C33H49N5O3 — CID 176947176
1-but-1-en-2-yl-2-methylhydrazine;[3-[1-ethyl-5-morpholin-4-yl-2-(2-propan-2-yl-3-pyridinyl)indol-3-yl]-2,2-dimethylpropyl] formate (PubChem CID 176947176) has the molecular formula C33H49N5O3 and a molecular weight of 563.79 g/mol. Its IUPAC name is 1-but-1-en-2-yl-2-methylhydrazine;[3-[1-ethyl-5-morpholin-4-yl-2-(2-propan-2-yl-3-pyridinyl)indol-3-yl]-2,2-dimethylpropyl] formate.
| Compound Name | 1-but-1-en-2-yl-2-methylhydrazine;[3-[1-ethyl-5-morpholin-4-yl-2-(2-propan-2-yl-3-pyridinyl)indol-3-yl]-2,2-dimethylpropyl] formate |
|---|---|
| PubChem CID | 176947176 |
| Molecular Formula | C33H49N5O3 |
| Molecular Weight | 563.79 g/mol |
| Exact Mass | 563.38 |
| IUPAC Name | 1-but-1-en-2-yl-2-methylhydrazine;[3-[1-ethyl-5-morpholin-4-yl-2-(2-propan-2-yl-3-pyridinyl)indol-3-yl]-2,2-dimethylpropyl] formate |
| SMILES | C=C(CC)NNC.CCn1c(-c2cccnc2C(C)C)c(CC(C)(C)COC=O)c2cc(N3CCOCC3)ccc21 |
| InChI | InChI=1S/C28H37N3O3.C5H12N2/c1-6-31-25-10-9-21(30-12-14-33-15-13-30)16-23(25)24(17-28(4,5)18-34-19-32)27(31)22-8-7-11-29-26(22)20(2)3;1-4-5(2)7-6-3/h7-11,16,19-20H,6,12-15,17-18H2,1-5H3;6-7H,2,4H2,1,3H3 |
| InChIKey | WHJQVJVEPTTXEM-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 80.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.79 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|