C35H50F3N5O2 — CID 166145566
[2,2-dimethyl-3-[5-[1-[6-(2-methylhydrazinyl)hexyl]pyrrolidin-3-yl]-2-(2-propan-2-yl-3-pyridinyl)-1-(2,2,2-trifluoroethyl)indol-3-yl]propyl] formate (PubChem CID 166145566) has the molecular formula C35H50F3N5O2 and a molecular weight of 629.81 g/mol. Its IUPAC name is [2,2-dimethyl-3-[5-[1-[6-(2-methylhydrazinyl)hexyl]pyrrolidin-3-yl]-2-(2-propan-2-yl-3-pyridinyl)-1-(2,2,2-trifluoroethyl)indol-3-yl]propyl] formate.
| Compound Name | [2,2-dimethyl-3-[5-[1-[6-(2-methylhydrazinyl)hexyl]pyrrolidin-3-yl]-2-(2-propan-2-yl-3-pyridinyl)-1-(2,2,2-trifluoroethyl)indol-3-yl]propyl] formate |
|---|---|
| PubChem CID | 166145566 |
| Molecular Formula | C35H50F3N5O2 |
| Molecular Weight | 629.81 g/mol |
| Exact Mass | 629.39 |
| IUPAC Name | [2,2-dimethyl-3-[5-[1-[6-(2-methylhydrazinyl)hexyl]pyrrolidin-3-yl]-2-(2-propan-2-yl-3-pyridinyl)-1-(2,2,2-trifluoroethyl)indol-3-yl]propyl] formate |
| SMILES | CNNCCCCCCN1CCC(c2ccc3c(c2)c(CC(C)(C)COC=O)c(-c2cccnc2C(C)C)n3CC(F)(F)F)C1 |
| InChI | InChI=1S/C35H50F3N5O2/c1-25(2)32-28(11-10-15-40-32)33-30(20-34(3,4)23-45-24-44)29-19-26(12-13-31(29)43(33)22-35(36,37)38)27-14-18-42(21-27)17-9-7-6-8-16-41-39-5/h10-13,15,19,24-25,27,39,41H,6-9,14,16-18,20-23H2,1-5H3 |
| InChIKey | XRHLIXDRNWRVRD-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 71.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.81 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|