C29H38BF3N2O4 — CID 161263247
3-[2-[2-[(1S)-1-methoxyethyl]-3-pyridinyl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-(2,2,2-trifluoroethyl)indol-3-yl]-2,2-dimethylpropan-1-ol (PubChem CID 161263247) has the molecular formula C29H38BF3N2O4 and a molecular weight of 546.44 g/mol. Its IUPAC name is 3-[2-[2-[(1S)-1-methoxyethyl]-3-pyridinyl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-(2,2,2-trifluoroethyl)indol-3-yl]-2,2-dimethylpropan-1-ol.
| Compound Name | 3-[2-[2-[(1S)-1-methoxyethyl]-3-pyridinyl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-(2,2,2-trifluoroethyl)indol-3-yl]-2,2-dimethylpropan-1-ol |
|---|---|
| PubChem CID | 161263247 |
| Molecular Formula | C29H38BF3N2O4 |
| Molecular Weight | 546.44 g/mol |
| Exact Mass | 546.29 |
| IUPAC Name | 3-[2-[2-[(1S)-1-methoxyethyl]-3-pyridinyl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-(2,2,2-trifluoroethyl)indol-3-yl]-2,2-dimethylpropan-1-ol |
| SMILES | CO[C@@H](C)c1ncccc1-c1c(CC(C)(C)CO)c2cc(B3OC(C)(C)C(C)(C)O3)ccc2n1CC(F)(F)F |
| InChI | InChI=1S/C29H38BF3N2O4/c1-18(37-8)24-20(10-9-13-34-24)25-22(15-26(2,3)17-36)21-14-19(30-38-27(4,5)28(6,7)39-30)11-12-23(21)35(25)16-29(31,32)33/h9-14,18,36H,15-17H2,1-8H3/t18-/m0/s1 |
| InChIKey | FCGAOANLHFEJGV-SFHVURJKSA-N |
| XLogP | 5.83 |
| TPSA | 65.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.44 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|