C36H53BN4O4 — CID 174216720
3-[2-[5-(4-cyclopropylpiperazin-1-yl)-2-(1-methoxyethyl)-3-pyridinyl]-1-ethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indol-3-yl]-2,2-dimethylpropan-1-ol (PubChem CID 174216720) has the molecular formula C36H53BN4O4 and a molecular weight of 616.66 g/mol. Its IUPAC name is 3-[2-[5-(4-cyclopropylpiperazin-1-yl)-2-(1-methoxyethyl)-3-pyridinyl]-1-ethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indol-3-yl]-2,2-dimethylpropan-1-ol.
| Compound Name | 3-[2-[5-(4-cyclopropylpiperazin-1-yl)-2-(1-methoxyethyl)-3-pyridinyl]-1-ethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indol-3-yl]-2,2-dimethylpropan-1-ol |
|---|---|
| PubChem CID | 174216720 |
| Molecular Formula | C36H53BN4O4 |
| Molecular Weight | 616.66 g/mol |
| Exact Mass | 616.42 |
| IUPAC Name | 3-[2-[5-(4-cyclopropylpiperazin-1-yl)-2-(1-methoxyethyl)-3-pyridinyl]-1-ethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indol-3-yl]-2,2-dimethylpropan-1-ol |
| SMILES | CCn1c(-c2cc(N3CCN(C4CC4)CC3)cnc2C(C)OC)c(CC(C)(C)CO)c2cc(B3OC(C)(C)C(C)(C)O3)ccc21 |
| InChI | InChI=1S/C36H53BN4O4/c1-10-41-31-14-11-25(37-44-35(5,6)36(7,8)45-37)19-28(31)30(21-34(3,4)23-42)33(41)29-20-27(22-38-32(29)24(2)43-9)40-17-15-39(16-18-40)26-12-13-26/h11,14,19-20,22,24,26,42H,10,12-13,15-18,21,23H2,1-9H3 |
| InChIKey | LSHITZHGQWCDRQ-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 72.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.66 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|