C33H45BrN4O3 — CID 174216676
[3-[2-[5-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-2-[(1S)-1-methoxyethyl]-3-pyridinyl]-5-bromo-1-ethylindol-3-yl]-2,2-dimethylpropyl] acetate (PubChem CID 174216676) has the molecular formula C33H45BrN4O3 and a molecular weight of 625.65 g/mol. Its IUPAC name is [3-[2-[5-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-2-[(1S)-1-methoxyethyl]-3-pyridinyl]-5-bromo-1-ethylindol-3-yl]-2,2-dimethylpropyl] acetate.
| Compound Name | [3-[2-[5-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-2-[(1S)-1-methoxyethyl]-3-pyridinyl]-5-bromo-1-ethylindol-3-yl]-2,2-dimethylpropyl] acetate |
|---|---|
| PubChem CID | 174216676 |
| Molecular Formula | C33H45BrN4O3 |
| Molecular Weight | 625.65 g/mol |
| Exact Mass | 624.27 |
| IUPAC Name | [3-[2-[5-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-2-[(1S)-1-methoxyethyl]-3-pyridinyl]-5-bromo-1-ethylindol-3-yl]-2,2-dimethylpropyl] acetate |
| SMILES | CCn1c(-c2cc(N3CCN4CCCCC4C3)cnc2[C@H](C)OC)c(CC(C)(C)COC(C)=O)c2cc(Br)ccc21 |
| InChI | InChI=1S/C33H45BrN4O3/c1-7-38-30-12-11-24(34)16-27(30)29(18-33(4,5)21-41-23(3)39)32(38)28-17-26(19-35-31(28)22(2)40-6)37-15-14-36-13-9-8-10-25(36)20-37/h11-12,16-17,19,22,25H,7-10,13-15,18,20-21H2,1-6H3/t22-,25?/m0/s1 |
| InChIKey | NRUPLONRURZOQI-XADRRFQNSA-N |
| XLogP | 7.00 |
| TPSA | 59.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.65 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |