C36H50N4O5 — CID 178086589
[3-[2-[5-(4-cyclopropylpiperazin-1-yl)-2-[(1S)-1-methoxyethyl]-3-pyridinyl]-1-ethyl-5-(4-oxobutoxy)indol-3-yl]-2,2-dimethylpropyl] acetate (PubChem CID 178086589) has the molecular formula C36H50N4O5 and a molecular weight of 618.82 g/mol. Its IUPAC name is [3-[2-[5-(4-cyclopropylpiperazin-1-yl)-2-[(1S)-1-methoxyethyl]-3-pyridinyl]-1-ethyl-5-(4-oxobutoxy)indol-3-yl]-2,2-dimethylpropyl] acetate.
| Compound Name | [3-[2-[5-(4-cyclopropylpiperazin-1-yl)-2-[(1S)-1-methoxyethyl]-3-pyridinyl]-1-ethyl-5-(4-oxobutoxy)indol-3-yl]-2,2-dimethylpropyl] acetate |
|---|---|
| PubChem CID | 178086589 |
| Molecular Formula | C36H50N4O5 |
| Molecular Weight | 618.82 g/mol |
| Exact Mass | 618.38 |
| IUPAC Name | [3-[2-[5-(4-cyclopropylpiperazin-1-yl)-2-[(1S)-1-methoxyethyl]-3-pyridinyl]-1-ethyl-5-(4-oxobutoxy)indol-3-yl]-2,2-dimethylpropyl] acetate |
| SMILES | CCn1c(-c2cc(N3CCN(C4CC4)CC3)cnc2[C@H](C)OC)c(CC(C)(C)COC(C)=O)c2cc(OCCCC=O)ccc21 |
| InChI | InChI=1S/C36H50N4O5/c1-7-40-33-13-12-29(44-19-9-8-18-41)21-30(33)32(22-36(4,5)24-45-26(3)42)35(40)31-20-28(23-37-34(31)25(2)43-6)39-16-14-38(15-17-39)27-10-11-27/h12-13,18,20-21,23,25,27H,7-11,14-17,19,22,24H2,1-6H3/t25-/m0/s1 |
| InChIKey | LXDHTXUTEBYYKA-VWLOTQADSA-N |
| XLogP | 6.20 |
| TPSA | 86.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.82 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|