C38H50N6O5 — CID 177219804
2-amino-3-[6-[2-[5-(4-cyclopropylpiperazin-1-yl)-2-(1-methoxyethyl)-3-pyridinyl]-1-ethyl-3-(3-hydroperoxy-2,2-dimethylpropyl)indol-5-yl]-4-oxo-1H-pyridin-2-yl]propanal (PubChem CID 177219804) has the molecular formula C38H50N6O5 and a molecular weight of 670.86 g/mol. Its IUPAC name is 2-amino-3-[6-[2-[5-(4-cyclopropylpiperazin-1-yl)-2-(1-methoxyethyl)-3-pyridinyl]-1-ethyl-3-(3-hydroperoxy-2,2-dimethylpropyl)indol-5-yl]-4-oxo-1H-pyridin-2-yl]propanal.
| Compound Name | 2-amino-3-[6-[2-[5-(4-cyclopropylpiperazin-1-yl)-2-(1-methoxyethyl)-3-pyridinyl]-1-ethyl-3-(3-hydroperoxy-2,2-dimethylpropyl)indol-5-yl]-4-oxo-1H-pyridin-2-yl]propanal |
|---|---|
| PubChem CID | 177219804 |
| Molecular Formula | C38H50N6O5 |
| Molecular Weight | 670.86 g/mol |
| Exact Mass | 670.38 |
| IUPAC Name | 2-amino-3-[6-[2-[5-(4-cyclopropylpiperazin-1-yl)-2-(1-methoxyethyl)-3-pyridinyl]-1-ethyl-3-(3-hydroperoxy-2,2-dimethylpropyl)indol-5-yl]-4-oxo-1H-pyridin-2-yl]propanal |
| SMILES | CCn1c(-c2cc(N3CCN(C4CC4)CC3)cnc2C(C)OC)c(CC(C)(C)COO)c2cc(-c3cc(=O)cc(CC(N)C=O)[nH]3)ccc21 |
| InChI | InChI=1S/C38H50N6O5/c1-6-44-35-10-7-25(34-19-30(46)17-27(41-34)16-26(39)22-45)15-31(35)33(20-38(3,4)23-49-47)37(44)32-18-29(21-40-36(32)24(2)48-5)43-13-11-42(12-14-43)28-8-9-28/h7,10,15,17-19,21-22,24,26,28,47H,6,8-9,11-14,16,20,23,39H2,1-5H3,(H,41,46) |
| InChIKey | OYBWHMQHMYUIPR-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 138.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.86 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|