C42H56BN3O6 — CID 176875053
benzyl 4-[5-[1-ethyl-3-(3-hydroxy-2,2-dimethylpropyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indol-2-yl]-6-[(1S)-1-methoxyethyl]-3-pyridinyl]piperidine-1-carboxylate (PubChem CID 176875053) has the molecular formula C42H56BN3O6 and a molecular weight of 709.74 g/mol. Its IUPAC name is benzyl 4-[5-[1-ethyl-3-(3-hydroxy-2,2-dimethylpropyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indol-2-yl]-6-[(1S)-1-methoxyethyl]-3-pyridinyl]piperidine-1-carboxylate.
| Compound Name | benzyl 4-[5-[1-ethyl-3-(3-hydroxy-2,2-dimethylpropyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indol-2-yl]-6-[(1S)-1-methoxyethyl]-3-pyridinyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 176875053 |
| Molecular Formula | C42H56BN3O6 |
| Molecular Weight | 709.74 g/mol |
| Exact Mass | 709.43 |
| IUPAC Name | benzyl 4-[5-[1-ethyl-3-(3-hydroxy-2,2-dimethylpropyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indol-2-yl]-6-[(1S)-1-methoxyethyl]-3-pyridinyl]piperidine-1-carboxylate |
| SMILES | CCn1c(-c2cc(C3CCN(C(=O)OCc4ccccc4)CC3)cnc2[C@H](C)OC)c(CC(C)(C)CO)c2cc(B3OC(C)(C)C(C)(C)O3)ccc21 |
| InChI | InChI=1S/C42H56BN3O6/c1-10-46-36-17-16-32(43-51-41(5,6)42(7,8)52-43)23-33(36)35(24-40(3,4)27-47)38(46)34-22-31(25-44-37(34)28(2)49-9)30-18-20-45(21-19-30)39(48)50-26-29-14-12-11-13-15-29/h11-17,22-23,25,28,30,47H,10,18-21,24,26-27H2,1-9H3/t28-/m0/s1 |
| InChIKey | WBSWNCOSLWOYHP-NDEPHWFRSA-N |
| XLogP | 7.81 |
| TPSA | 95.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.74 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|